C15H13F3O3 — CID 61089367
(2,4-dimethoxyphenyl)-(2,4,6-trifluorophenyl)methanol (PubChem CID 61089367) has the molecular formula C15H13F3O3 and a molecular weight of 298.26 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)-(2,4,6-trifluorophenyl)methanol.
| Compound Name | (2,4-dimethoxyphenyl)-(2,4,6-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 61089367 |
| Molecular Formula | C15H13F3O3 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | (2,4-dimethoxyphenyl)-(2,4,6-trifluorophenyl)methanol |
| SMILES | COc1ccc(C(O)c2c(F)cc(F)cc2F)c(OC)c1 |
| InChI | InChI=1S/C15H13F3O3/c1-20-9-3-4-10(13(7-9)21-2)15(19)14-11(17)5-8(16)6-12(14)18/h3-7,15,19H,1-2H3 |
| InChIKey | CAXDYEKBMBZHHA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |