C14H10BrF3O2 — CID 103396120
(5-bromo-4-fluoro-2-methoxyphenyl)-(2,6-difluorophenyl)methanol (PubChem CID 103396120) has the molecular formula C14H10BrF3O2 and a molecular weight of 347.13 g/mol. Its IUPAC name is (5-bromo-4-fluoro-2-methoxyphenyl)-(2,6-difluorophenyl)methanol.
| Compound Name | (5-bromo-4-fluoro-2-methoxyphenyl)-(2,6-difluorophenyl)methanol |
|---|---|
| PubChem CID | 103396120 |
| Molecular Formula | C14H10BrF3O2 |
| Molecular Weight | 347.13 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | (5-bromo-4-fluoro-2-methoxyphenyl)-(2,6-difluorophenyl)methanol |
| SMILES | COc1cc(F)c(Br)cc1C(O)c1c(F)cccc1F |
| InChI | InChI=1S/C14H10BrF3O2/c1-20-12-6-11(18)8(15)5-7(12)14(19)13-9(16)3-2-4-10(13)17/h2-6,14,19H,1H3 |
| InChIKey | UKSPMRWLWAMVQA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.13 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |