C16H17FO4 — CID 65433281
(2,5-dimethoxyphenyl)-(2-fluoro-6-methoxyphenyl)methanol (PubChem CID 65433281) has the molecular formula C16H17FO4 and a molecular weight of 292.31 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)-(2-fluoro-6-methoxyphenyl)methanol.
| Compound Name | (2,5-dimethoxyphenyl)-(2-fluoro-6-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 65433281 |
| Molecular Formula | C16H17FO4 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (2,5-dimethoxyphenyl)-(2-fluoro-6-methoxyphenyl)methanol |
| SMILES | COc1ccc(OC)c(C(O)c2c(F)cccc2OC)c1 |
| InChI | InChI=1S/C16H17FO4/c1-19-10-7-8-13(20-2)11(9-10)16(18)15-12(17)5-4-6-14(15)21-3/h4-9,16,18H,1-3H3 |
| InChIKey | JGQJTKFATFRVRJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |