C15H14F2O3 — CID 61100568
(3,5-difluorophenyl)-(2,5-dimethoxyphenyl)methanol (PubChem CID 61100568) has the molecular formula C15H14F2O3 and a molecular weight of 280.27 g/mol. Its IUPAC name is (3,5-difluorophenyl)-(2,5-dimethoxyphenyl)methanol.
| Compound Name | (3,5-difluorophenyl)-(2,5-dimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 61100568 |
| Molecular Formula | C15H14F2O3 |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (3,5-difluorophenyl)-(2,5-dimethoxyphenyl)methanol |
| SMILES | COc1ccc(OC)c(C(O)c2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C15H14F2O3/c1-19-12-3-4-14(20-2)13(8-12)15(18)9-5-10(16)7-11(17)6-9/h3-8,15,18H,1-2H3 |
| InChIKey | XQCMBJSLYWJACD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |