C16H17BrO3 — CID 81447590
(4-bromo-3-methylphenyl)-(2,5-dimethoxyphenyl)methanol (PubChem CID 81447590) has the molecular formula C16H17BrO3 and a molecular weight of 337.21 g/mol. Its IUPAC name is (4-bromo-3-methylphenyl)-(2,5-dimethoxyphenyl)methanol.
| Compound Name | (4-bromo-3-methylphenyl)-(2,5-dimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 81447590 |
| Molecular Formula | C16H17BrO3 |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | (4-bromo-3-methylphenyl)-(2,5-dimethoxyphenyl)methanol |
| SMILES | COc1ccc(OC)c(C(O)c2ccc(Br)c(C)c2)c1 |
| InChI | InChI=1S/C16H17BrO3/c1-10-8-11(4-6-14(10)17)16(18)13-9-12(19-2)5-7-15(13)20-3/h4-9,16,18H,1-3H3 |
| InChIKey | YXJYDIXNADJMDS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |