C13H13IO3S — CID 79684219
(2,5-dimethoxyphenyl)-(5-iodothiophen-3-yl)methanol (PubChem CID 79684219) has the molecular formula C13H13IO3S and a molecular weight of 376.22 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)-(5-iodothiophen-3-yl)methanol.
| Compound Name | (2,5-dimethoxyphenyl)-(5-iodothiophen-3-yl)methanol |
|---|---|
| PubChem CID | 79684219 |
| Molecular Formula | C13H13IO3S |
| Molecular Weight | 376.22 g/mol |
| Exact Mass | 375.96 |
| IUPAC Name | (2,5-dimethoxyphenyl)-(5-iodothiophen-3-yl)methanol |
| SMILES | COc1ccc(OC)c(C(O)c2csc(I)c2)c1 |
| InChI | InChI=1S/C13H13IO3S/c1-16-9-3-4-11(17-2)10(6-9)13(15)8-5-12(14)18-7-8/h3-7,13,15H,1-2H3 |
| InChIKey | JCDKMNLBPMKQIV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.22 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|