C15H18INO2S — CID 79691413
3-amino-1-(5-iodothiophen-3-yl)-2-(3-methoxy-4-methylphenyl)propan-1-ol (PubChem CID 79691413) has the molecular formula C15H18INO2S and a molecular weight of 403.29 g/mol. Its IUPAC name is 3-amino-1-(5-iodothiophen-3-yl)-2-(3-methoxy-4-methylphenyl)propan-1-ol.
| Compound Name | 3-amino-1-(5-iodothiophen-3-yl)-2-(3-methoxy-4-methylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 79691413 |
| Molecular Formula | C15H18INO2S |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | 3-amino-1-(5-iodothiophen-3-yl)-2-(3-methoxy-4-methylphenyl)propan-1-ol |
| SMILES | COc1cc(C(CN)C(O)c2csc(I)c2)ccc1C |
| InChI | InChI=1S/C15H18INO2S/c1-9-3-4-10(5-13(9)19-2)12(7-17)15(18)11-6-14(16)20-8-11/h3-6,8,12,15,18H,7,17H2,1-2H3 |
| InChIKey | KXSRFIQPNCRWNF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|