C17H20ClNO2 — CID 65186281
3-amino-2-(3-chlorophenyl)-1-(3-methoxy-4-methylphenyl)propan-1-ol (PubChem CID 65186281) has the molecular formula C17H20ClNO2 and a molecular weight of 305.81 g/mol. Its IUPAC name is 3-amino-2-(3-chlorophenyl)-1-(3-methoxy-4-methylphenyl)propan-1-ol.
| Compound Name | 3-amino-2-(3-chlorophenyl)-1-(3-methoxy-4-methylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 65186281 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 3-amino-2-(3-chlorophenyl)-1-(3-methoxy-4-methylphenyl)propan-1-ol |
| SMILES | COc1cc(C(O)C(CN)c2cccc(Cl)c2)ccc1C |
| InChI | InChI=1S/C17H20ClNO2/c1-11-6-7-13(9-16(11)21-2)17(20)15(10-19)12-4-3-5-14(18)8-12/h3-9,15,17,20H,10,19H2,1-2H3 |
| InChIKey | RZOTWKNBBWOLOB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |