C16H16F2O3 — CID 61081893
(2,6-difluorophenyl)-(4,5-dimethoxy-2-methylphenyl)methanol (PubChem CID 61081893) has the molecular formula C16H16F2O3 and a molecular weight of 294.30 g/mol. Its IUPAC name is (2,6-difluorophenyl)-(4,5-dimethoxy-2-methylphenyl)methanol.
| Compound Name | (2,6-difluorophenyl)-(4,5-dimethoxy-2-methylphenyl)methanol |
|---|---|
| PubChem CID | 61081893 |
| Molecular Formula | C16H16F2O3 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (2,6-difluorophenyl)-(4,5-dimethoxy-2-methylphenyl)methanol |
| SMILES | COc1cc(C)c(C(O)c2c(F)cccc2F)cc1OC |
| InChI | InChI=1S/C16H16F2O3/c1-9-7-13(20-2)14(21-3)8-10(9)16(19)15-11(17)5-4-6-12(15)18/h4-8,16,19H,1-3H3 |
| InChIKey | QCQVFJQOMUFYOM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |