C15H14Cl2O3 — CID 61087695
(2,4-dichlorophenyl)-(2,4-dimethoxyphenyl)methanol (PubChem CID 61087695) has the molecular formula C15H14Cl2O3 and a molecular weight of 313.18 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-(2,4-dimethoxyphenyl)methanol.
| Compound Name | (2,4-dichlorophenyl)-(2,4-dimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 61087695 |
| Molecular Formula | C15H14Cl2O3 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | (2,4-dichlorophenyl)-(2,4-dimethoxyphenyl)methanol |
| SMILES | COc1ccc(C(O)c2ccc(Cl)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C15H14Cl2O3/c1-19-10-4-6-12(14(8-10)20-2)15(18)11-5-3-9(16)7-13(11)17/h3-8,15,18H,1-2H3 |
| InChIKey | QDPSYMKBULTAMI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |