C19H22Cl2O3 — CID 11667808
1-(2,4-dichlorophenyl)-3-(2,4-dimethoxyphenyl)pentan-1-ol (PubChem CID 11667808) has the molecular formula C19H22Cl2O3 and a molecular weight of 369.29 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-(2,4-dimethoxyphenyl)pentan-1-ol.
| Compound Name | 1-(2,4-dichlorophenyl)-3-(2,4-dimethoxyphenyl)pentan-1-ol |
|---|---|
| PubChem CID | 11667808 |
| Molecular Formula | C19H22Cl2O3 |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-(2,4-dimethoxyphenyl)pentan-1-ol |
| SMILES | CCC(CC(O)c1ccc(Cl)cc1Cl)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C19H22Cl2O3/c1-4-12(15-8-6-14(23-2)11-19(15)24-3)9-18(22)16-7-5-13(20)10-17(16)21/h5-8,10-12,18,22H,4,9H2,1-3H3 |
| InChIKey | BTRRMOPUAPVWKX-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |