C19H20Cl2O3 — CID 11710376
3-(2,4-dichlorophenyl)-1-(2,4-dimethoxyphenyl)pentan-1-one (PubChem CID 11710376) has the molecular formula C19H20Cl2O3 and a molecular weight of 367.27 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-(2,4-dimethoxyphenyl)pentan-1-one.
| Compound Name | 3-(2,4-dichlorophenyl)-1-(2,4-dimethoxyphenyl)pentan-1-one |
|---|---|
| PubChem CID | 11710376 |
| Molecular Formula | C19H20Cl2O3 |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-(2,4-dimethoxyphenyl)pentan-1-one |
| SMILES | CCC(CC(=O)c1ccc(OC)cc1OC)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H20Cl2O3/c1-4-12(15-7-5-13(20)10-17(15)21)9-18(22)16-8-6-14(23-2)11-19(16)24-3/h5-8,10-12H,4,9H2,1-3H3 |
| InChIKey | GIDIXNGJJVDLJR-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |