C22H28O4 — CID 11681930
3-(2,4-dimethoxyphenyl)-1-(4-prop-2-enoxyphenyl)pentan-1-ol (PubChem CID 11681930) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-1-(4-prop-2-enoxyphenyl)pentan-1-ol.
| Compound Name | 3-(2,4-dimethoxyphenyl)-1-(4-prop-2-enoxyphenyl)pentan-1-ol |
|---|---|
| PubChem CID | 11681930 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-1-(4-prop-2-enoxyphenyl)pentan-1-ol |
| SMILES | C=CCOc1ccc(C(O)CC(CC)c2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C22H28O4/c1-5-13-26-18-9-7-17(8-10-18)21(23)14-16(6-2)20-12-11-19(24-3)15-22(20)25-4/h5,7-12,15-16,21,23H,1,6,13-14H2,2-4H3 |
| InChIKey | ALNNSQCKTHMIRA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|