C24H32O4 — CID 11717940
3-(2,4-dimethoxyphenyl)-1-(4-prop-2-enoxyphenyl)heptan-1-ol (PubChem CID 11717940) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-1-(4-prop-2-enoxyphenyl)heptan-1-ol.
| Compound Name | 3-(2,4-dimethoxyphenyl)-1-(4-prop-2-enoxyphenyl)heptan-1-ol |
|---|---|
| PubChem CID | 11717940 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-1-(4-prop-2-enoxyphenyl)heptan-1-ol |
| SMILES | C=CCOc1ccc(C(O)CC(CCCC)c2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C24H32O4/c1-5-7-8-19(22-14-13-21(26-3)17-24(22)27-4)16-23(25)18-9-11-20(12-10-18)28-15-6-2/h6,9-14,17,19,23,25H,2,5,7-8,15-16H2,1,3-4H3 |
| InChIKey | LMPSGVGQPZHEPO-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|