C14H14ClNO3 — CID 105095989
(3-chloro-4-pyridinyl)-(2,4-dimethoxyphenyl)methanol (PubChem CID 105095989) has the molecular formula C14H14ClNO3 and a molecular weight of 279.72 g/mol. Its IUPAC name is (3-chloro-4-pyridinyl)-(2,4-dimethoxyphenyl)methanol.
| Compound Name | (3-chloro-4-pyridinyl)-(2,4-dimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 105095989 |
| Molecular Formula | C14H14ClNO3 |
| Molecular Weight | 279.72 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | (3-chloro-4-pyridinyl)-(2,4-dimethoxyphenyl)methanol |
| SMILES | COc1ccc(C(O)c2ccncc2Cl)c(OC)c1 |
| InChI | InChI=1S/C14H14ClNO3/c1-18-9-3-4-11(13(7-9)19-2)14(17)10-5-6-16-8-12(10)15/h3-8,14,17H,1-2H3 |
| InChIKey | JXQLVOBVIVPYEY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.72 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |