C15H17ClO2S — CID 61084593
3-[chloro-(2,6-dimethoxyphenyl)methyl]-2,5-dimethylthiophene (PubChem CID 61084593) has the molecular formula C15H17ClO2S and a molecular weight of 296.82 g/mol. Its IUPAC name is 3-[chloro-(2,6-dimethoxyphenyl)methyl]-2,5-dimethylthiophene.
| Compound Name | 3-[chloro-(2,6-dimethoxyphenyl)methyl]-2,5-dimethylthiophene |
|---|---|
| PubChem CID | 61084593 |
| Molecular Formula | C15H17ClO2S |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 3-[chloro-(2,6-dimethoxyphenyl)methyl]-2,5-dimethylthiophene |
| SMILES | COc1cccc(OC)c1C(Cl)c1cc(C)sc1C |
| InChI | InChI=1S/C15H17ClO2S/c1-9-8-11(10(2)19-9)15(16)14-12(17-3)6-5-7-13(14)18-4/h5-8,15H,1-4H3 |
| InChIKey | ZEXLKARYTSNLFN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|