C10H13ClO2 — CID 130480511
2-(1-chloroethyl)-1,3-dimethoxybenzene (PubChem CID 130480511) has the molecular formula C10H13ClO2 and a molecular weight of 200.66 g/mol. Its IUPAC name is 2-(1-chloroethyl)-1,3-dimethoxybenzene.
| Compound Name | 2-(1-chloroethyl)-1,3-dimethoxybenzene |
|---|---|
| PubChem CID | 130480511 |
| Molecular Formula | C10H13ClO2 |
| Molecular Weight | 200.66 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 2-(1-chloroethyl)-1,3-dimethoxybenzene |
| SMILES | COc1cccc(OC)c1C(C)Cl |
| InChI | InChI=1S/C10H13ClO2/c1-7(11)10-8(12-2)5-4-6-9(10)13-3/h4-7H,1-3H3 |
| InChIKey | CONHAPUBCXJTLN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.66 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|