C24H40O4P2 — CID 142028900
bis(1,3-dimethoxy-2-propan-2-ylbenzene);2-phosphanylethylphosphane (PubChem CID 142028900) has the molecular formula C24H40O4P2 and a molecular weight of 454.53 g/mol. Its IUPAC name is bis(1,3-dimethoxy-2-propan-2-ylbenzene);2-phosphanylethylphosphane.
| Compound Name | bis(1,3-dimethoxy-2-propan-2-ylbenzene);2-phosphanylethylphosphane |
|---|---|
| PubChem CID | 142028900 |
| Molecular Formula | C24H40O4P2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | bis(1,3-dimethoxy-2-propan-2-ylbenzene);2-phosphanylethylphosphane |
| SMILES | COc1cccc(OC)c1C(C)C.COc1cccc(OC)c1C(C)C.PCCP |
| InChI | InChI=1S/2C11H16O2.C2H8P2/c2*1-8(2)11-9(12-3)6-5-7-10(11)13-4;3-1-2-4/h2*5-8H,1-4H3;1-4H2 |
| InChIKey | PTZUMPXHYHKSGH-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|