C11H18ClNO2 — CID 171201163
(1R)-1-(2,6-dimethoxyphenyl)propan-1-amine;hydrochloride (PubChem CID 171201163) has the molecular formula C11H18ClNO2 and a molecular weight of 231.72 g/mol. Its IUPAC name is (1R)-1-(2,6-dimethoxyphenyl)propan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(2,6-dimethoxyphenyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171201163 |
| Molecular Formula | C11H18ClNO2 |
| Molecular Weight | 231.72 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | (1R)-1-(2,6-dimethoxyphenyl)propan-1-amine;hydrochloride |
| SMILES | CC[C@@H](N)c1c(OC)cccc1OC.Cl |
| InChI | InChI=1S/C11H17NO2.ClH/c1-4-8(12)11-9(13-2)6-5-7-10(11)14-3;/h5-8H,4,12H2,1-3H3;1H/t8-;/m1./s1 |
| InChIKey | HPKQUMLPXYXCRO-DDWIOCJRSA-N |
| XLogP | 2.54 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.72 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |