C10H17ClN2O2 — CID 171201155
(1S)-1-(2,6-dimethoxyphenyl)ethane-1,2-diamine;hydrochloride (PubChem CID 171201155) has the molecular formula C10H17ClN2O2 and a molecular weight of 232.71 g/mol. Its IUPAC name is (1S)-1-(2,6-dimethoxyphenyl)ethane-1,2-diamine;hydrochloride.
| Compound Name | (1S)-1-(2,6-dimethoxyphenyl)ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 171201155 |
| Molecular Formula | C10H17ClN2O2 |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | (1S)-1-(2,6-dimethoxyphenyl)ethane-1,2-diamine;hydrochloride |
| SMILES | COc1cccc(OC)c1[C@H](N)CN.Cl |
| InChI | InChI=1S/C10H16N2O2.ClH/c1-13-8-4-3-5-9(14-2)10(8)7(12)6-11;/h3-5,7H,6,11-12H2,1-2H3;1H/t7-;/m1./s1 |
| InChIKey | ZYSFTJAKOZDATB-OGFXRTJISA-N |
| XLogP | 1.08 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |