C10H16N2O — CID 55283458
1-(2-methoxy-6-methylphenyl)ethane-1,2-diamine (PubChem CID 55283458) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-(2-methoxy-6-methylphenyl)ethane-1,2-diamine.
| Compound Name | 1-(2-methoxy-6-methylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 55283458 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-(2-methoxy-6-methylphenyl)ethane-1,2-diamine |
| SMILES | COc1cccc(C)c1C(N)CN |
| InChI | InChI=1S/C10H16N2O/c1-7-4-3-5-9(13-2)10(7)8(12)6-11/h3-5,8H,6,11-12H2,1-2H3 |
| InChIKey | NDOQYBATTZCKML-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |