C15H18O2S — CID 61087046
1-(2,5-dimethylthiophen-3-yl)-2-(2-methoxyphenyl)ethanol (PubChem CID 61087046) has the molecular formula C15H18O2S and a molecular weight of 262.37 g/mol. Its IUPAC name is 1-(2,5-dimethylthiophen-3-yl)-2-(2-methoxyphenyl)ethanol.
| Compound Name | 1-(2,5-dimethylthiophen-3-yl)-2-(2-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 61087046 |
| Molecular Formula | C15H18O2S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 1-(2,5-dimethylthiophen-3-yl)-2-(2-methoxyphenyl)ethanol |
| SMILES | COc1ccccc1CC(O)c1cc(C)sc1C |
| InChI | InChI=1S/C15H18O2S/c1-10-8-13(11(2)18-10)14(16)9-12-6-4-5-7-15(12)17-3/h4-8,14,16H,9H2,1-3H3 |
| InChIKey | LTNPWZJZUVFGIR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |