C17H19ClO3 — CID 61084322
1-[chloro-(2,6-dimethoxyphenyl)methyl]-4-methoxy-2-methylbenzene (PubChem CID 61084322) has the molecular formula C17H19ClO3 and a molecular weight of 306.79 g/mol. Its IUPAC name is 1-[chloro-(2,6-dimethoxyphenyl)methyl]-4-methoxy-2-methylbenzene.
| Compound Name | 1-[chloro-(2,6-dimethoxyphenyl)methyl]-4-methoxy-2-methylbenzene |
|---|---|
| PubChem CID | 61084322 |
| Molecular Formula | C17H19ClO3 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-[chloro-(2,6-dimethoxyphenyl)methyl]-4-methoxy-2-methylbenzene |
| SMILES | COc1ccc(C(Cl)c2c(OC)cccc2OC)c(C)c1 |
| InChI | InChI=1S/C17H19ClO3/c1-11-10-12(19-2)8-9-13(11)17(18)16-14(20-3)6-5-7-15(16)21-4/h5-10,17H,1-4H3 |
| InChIKey | LTIIYZGKJYJDCV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|