C18H21ClO2 — CID 63429668
2-[chloro-(2,5-dimethoxyphenyl)methyl]-1,3,5-trimethylbenzene (PubChem CID 63429668) has the molecular formula C18H21ClO2 and a molecular weight of 304.82 g/mol. Its IUPAC name is 2-[chloro-(2,5-dimethoxyphenyl)methyl]-1,3,5-trimethylbenzene.
| Compound Name | 2-[chloro-(2,5-dimethoxyphenyl)methyl]-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 63429668 |
| Molecular Formula | C18H21ClO2 |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-[chloro-(2,5-dimethoxyphenyl)methyl]-1,3,5-trimethylbenzene |
| SMILES | COc1ccc(OC)c(C(Cl)c2c(C)cc(C)cc2C)c1 |
| InChI | InChI=1S/C18H21ClO2/c1-11-8-12(2)17(13(3)9-11)18(19)15-10-14(20-4)6-7-16(15)21-5/h6-10,18H,1-5H3 |
| InChIKey | IRLBSRQHOUCUCG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|