C15H15ClO2 — CID 61083516
2-[chloro(phenyl)methyl]-1,4-dimethoxybenzene (PubChem CID 61083516) has the molecular formula C15H15ClO2 and a molecular weight of 262.74 g/mol. Its IUPAC name is 2-[chloro(phenyl)methyl]-1,4-dimethoxybenzene.
| Compound Name | 2-[chloro(phenyl)methyl]-1,4-dimethoxybenzene |
|---|---|
| PubChem CID | 61083516 |
| Molecular Formula | C15H15ClO2 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2-[chloro(phenyl)methyl]-1,4-dimethoxybenzene |
| SMILES | COc1ccc(OC)c(C(Cl)c2ccccc2)c1 |
| InChI | InChI=1S/C15H15ClO2/c1-17-12-8-9-14(18-2)13(10-12)15(16)11-6-4-3-5-7-11/h3-10,15H,1-2H3 |
| InChIKey | HIASLNXRWWZDPL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|