C16H17ClO3 — CID 61083307
1-[chloro(phenyl)methyl]-2,4,5-trimethoxybenzene (PubChem CID 61083307) has the molecular formula C16H17ClO3 and a molecular weight of 292.76 g/mol. Its IUPAC name is 1-[chloro(phenyl)methyl]-2,4,5-trimethoxybenzene.
| Compound Name | 1-[chloro(phenyl)methyl]-2,4,5-trimethoxybenzene |
|---|---|
| PubChem CID | 61083307 |
| Molecular Formula | C16H17ClO3 |
| Molecular Weight | 292.76 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 1-[chloro(phenyl)methyl]-2,4,5-trimethoxybenzene |
| SMILES | COc1cc(OC)c(C(Cl)c2ccccc2)cc1OC |
| InChI | InChI=1S/C16H17ClO3/c1-18-13-10-15(20-3)14(19-2)9-12(13)16(17)11-7-5-4-6-8-11/h4-10,16H,1-3H3 |
| InChIKey | IDSRASSEZCZQEI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.76 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|