C16H16Cl2O2 — CID 63432995
1-chloro-2-[chloro-(3-methylphenyl)methyl]-4,5-dimethoxybenzene (PubChem CID 63432995) has the molecular formula C16H16Cl2O2 and a molecular weight of 311.21 g/mol. Its IUPAC name is 1-chloro-2-[chloro-(3-methylphenyl)methyl]-4,5-dimethoxybenzene.
| Compound Name | 1-chloro-2-[chloro-(3-methylphenyl)methyl]-4,5-dimethoxybenzene |
|---|---|
| PubChem CID | 63432995 |
| Molecular Formula | C16H16Cl2O2 |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 1-chloro-2-[chloro-(3-methylphenyl)methyl]-4,5-dimethoxybenzene |
| SMILES | COc1cc(Cl)c(C(Cl)c2cccc(C)c2)cc1OC |
| InChI | InChI=1S/C16H16Cl2O2/c1-10-5-4-6-11(7-10)16(18)12-8-14(19-2)15(20-3)9-13(12)17/h4-9,16H,1-3H3 |
| InChIKey | PDCGNAQCAUXTOH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|