C16H18ClNO3 — CID 115811290
(3-chlorophenyl)-(2,4,5-trimethoxyphenyl)methanamine (PubChem CID 115811290) has the molecular formula C16H18ClNO3 and a molecular weight of 307.78 g/mol. Its IUPAC name is (3-chlorophenyl)-(2,4,5-trimethoxyphenyl)methanamine.
| Compound Name | (3-chlorophenyl)-(2,4,5-trimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 115811290 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | (3-chlorophenyl)-(2,4,5-trimethoxyphenyl)methanamine |
| SMILES | COc1cc(OC)c(C(N)c2cccc(Cl)c2)cc1OC |
| InChI | InChI=1S/C16H18ClNO3/c1-19-13-9-15(21-3)14(20-2)8-12(13)16(18)10-5-4-6-11(17)7-10/h4-9,16H,18H2,1-3H3 |
| InChIKey | CHJVDQGSQNKCSN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |