C13H10Cl3N — CID 115811895
(3-chlorophenyl)-(3,5-dichlorophenyl)methanamine (PubChem CID 115811895) has the molecular formula C13H10Cl3N and a molecular weight of 286.59 g/mol. Its IUPAC name is (3-chlorophenyl)-(3,5-dichlorophenyl)methanamine.
| Compound Name | (3-chlorophenyl)-(3,5-dichlorophenyl)methanamine |
|---|---|
| PubChem CID | 115811895 |
| Molecular Formula | C13H10Cl3N |
| Molecular Weight | 286.59 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | (3-chlorophenyl)-(3,5-dichlorophenyl)methanamine |
| SMILES | NC(c1cccc(Cl)c1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H10Cl3N/c14-10-3-1-2-8(4-10)13(17)9-5-11(15)7-12(16)6-9/h1-7,13H,17H2 |
| InChIKey | AZBAXAUXQKBEJU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.59 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |