C13H9BrCl2FN — CID 79747674
(3-bromo-4-fluorophenyl)-(3,5-dichlorophenyl)methanamine (PubChem CID 79747674) has the molecular formula C13H9BrCl2FN and a molecular weight of 349.03 g/mol. Its IUPAC name is (3-bromo-4-fluorophenyl)-(3,5-dichlorophenyl)methanamine.
| Compound Name | (3-bromo-4-fluorophenyl)-(3,5-dichlorophenyl)methanamine |
|---|---|
| PubChem CID | 79747674 |
| Molecular Formula | C13H9BrCl2FN |
| Molecular Weight | 349.03 g/mol |
| Exact Mass | 346.93 |
| IUPAC Name | (3-bromo-4-fluorophenyl)-(3,5-dichlorophenyl)methanamine |
| SMILES | NC(c1cc(Cl)cc(Cl)c1)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C13H9BrCl2FN/c14-11-5-7(1-2-12(11)17)13(18)8-3-9(15)6-10(16)4-8/h1-6,13H,18H2 |
| InChIKey | RAECMZBCANOXBZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.03 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |