C11H15ClN2 — CID 130854534
1-(3-chlorophenyl)-2-cyclopropylethane-1,2-diamine (PubChem CID 130854534) has the molecular formula C11H15ClN2 and a molecular weight of 210.71 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-cyclopropylethane-1,2-diamine.
| Compound Name | 1-(3-chlorophenyl)-2-cyclopropylethane-1,2-diamine |
|---|---|
| PubChem CID | 130854534 |
| Molecular Formula | C11H15ClN2 |
| Molecular Weight | 210.71 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 1-(3-chlorophenyl)-2-cyclopropylethane-1,2-diamine |
| SMILES | NC(c1cccc(Cl)c1)C(N)C1CC1 |
| InChI | InChI=1S/C11H15ClN2/c12-9-3-1-2-8(6-9)11(14)10(13)7-4-5-7/h1-3,6-7,10-11H,4-5,13-14H2 |
| InChIKey | SUZVHKKDQMLPDJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.71 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |