C12H17ClN2 — CID 171314128
(R)-(3-chlorophenyl)-piperidin-4-ylmethanamine (PubChem CID 171314128) has the molecular formula C12H17ClN2 and a molecular weight of 224.73 g/mol. Its IUPAC name is (R)-(3-chlorophenyl)-piperidin-4-ylmethanamine.
| Compound Name | (R)-(3-chlorophenyl)-piperidin-4-ylmethanamine |
|---|---|
| PubChem CID | 171314128 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | (R)-(3-chlorophenyl)-piperidin-4-ylmethanamine |
| SMILES | N[C@@H](c1cccc(Cl)c1)C1CCNCC1 |
| InChI | InChI=1S/C12H17ClN2/c13-11-3-1-2-10(8-11)12(14)9-4-6-15-7-5-9/h1-3,8-9,12,15H,4-7,14H2/t12-/m1/s1 |
| InChIKey | MIZHIKQUZSINIJ-GFCCVEGCSA-N |
| XLogP | 2.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |