C13H19ClF2N2O — CID 171314391
(R)-[3-(difluoromethoxy)phenyl]-piperidin-4-ylmethanamine;hydrochloride (PubChem CID 171314391) has the molecular formula C13H19ClF2N2O and a molecular weight of 292.76 g/mol. Its IUPAC name is (R)-[3-(difluoromethoxy)phenyl]-piperidin-4-ylmethanamine;hydrochloride.
| Compound Name | (R)-[3-(difluoromethoxy)phenyl]-piperidin-4-ylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 171314391 |
| Molecular Formula | C13H19ClF2N2O |
| Molecular Weight | 292.76 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | (R)-[3-(difluoromethoxy)phenyl]-piperidin-4-ylmethanamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1cccc(OC(F)F)c1)C1CCNCC1 |
| InChI | InChI=1S/C13H18F2N2O.ClH/c14-13(15)18-11-3-1-2-10(8-11)12(16)9-4-6-17-7-5-9;/h1-3,8-9,12-13,17H,4-7,16H2;1H/t12-;/m1./s1 |
| InChIKey | YKSQKCRKQFJAAC-UTONKHPSSA-N |
| XLogP | 2.71 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.76 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |