C12H16ClF2NO — CID 171225709
(S)-cyclobutyl-[3-(difluoromethoxy)phenyl]methanamine;hydrochloride (PubChem CID 171225709) has the molecular formula C12H16ClF2NO and a molecular weight of 263.71 g/mol. Its IUPAC name is (S)-cyclobutyl-[3-(difluoromethoxy)phenyl]methanamine;hydrochloride.
| Compound Name | (S)-cyclobutyl-[3-(difluoromethoxy)phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 171225709 |
| Molecular Formula | C12H16ClF2NO |
| Molecular Weight | 263.71 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | (S)-cyclobutyl-[3-(difluoromethoxy)phenyl]methanamine;hydrochloride |
| SMILES | Cl.N[C@H](c1cccc(OC(F)F)c1)C1CCC1 |
| InChI | InChI=1S/C12H15F2NO.ClH/c13-12(14)16-10-6-2-5-9(7-10)11(15)8-3-1-4-8;/h2,5-8,11-12H,1,3-4,15H2;1H/t11-;/m0./s1 |
| InChIKey | CHLYCYKZWASFAS-MERQFXBCSA-N |
| XLogP | 3.51 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.71 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |