C19H24ClNO — CID 171220083
(S)-cyclohexyl-(3-phenoxyphenyl)methanamine;hydrochloride (PubChem CID 171220083) has the molecular formula C19H24ClNO and a molecular weight of 317.86 g/mol. Its IUPAC name is (S)-cyclohexyl-(3-phenoxyphenyl)methanamine;hydrochloride.
| Compound Name | (S)-cyclohexyl-(3-phenoxyphenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171220083 |
| Molecular Formula | C19H24ClNO |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (S)-cyclohexyl-(3-phenoxyphenyl)methanamine;hydrochloride |
| SMILES | Cl.N[C@H](c1cccc(Oc2ccccc2)c1)C1CCCCC1 |
| InChI | InChI=1S/C19H23NO.ClH/c20-19(15-8-3-1-4-9-15)16-10-7-13-18(14-16)21-17-11-5-2-6-12-17;/h2,5-7,10-15,19H,1,3-4,8-9,20H2;1H/t19-;/m0./s1 |
| InChIKey | ANRMKWNZWZZTJJ-FYZYNONXSA-N |
| XLogP | 5.48 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |