C14H22ClNO — CID 171225239
(S)-cyclopentyl-(3-ethoxyphenyl)methanamine;hydrochloride (PubChem CID 171225239) has the molecular formula C14H22ClNO and a molecular weight of 255.79 g/mol. Its IUPAC name is (S)-cyclopentyl-(3-ethoxyphenyl)methanamine;hydrochloride.
| Compound Name | (S)-cyclopentyl-(3-ethoxyphenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171225239 |
| Molecular Formula | C14H22ClNO |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | (S)-cyclopentyl-(3-ethoxyphenyl)methanamine;hydrochloride |
| SMILES | CCOc1cccc([C@@H](N)C2CCCC2)c1.Cl |
| InChI | InChI=1S/C14H21NO.ClH/c1-2-16-13-9-5-8-12(10-13)14(15)11-6-3-4-7-11;/h5,8-11,14H,2-4,6-7,15H2,1H3;1H/t14-;/m0./s1 |
| InChIKey | AXHLVJLUNRZQRQ-UQKRIMTDSA-N |
| XLogP | 3.70 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |