C18H30Cl2N2O — CID 171290527
1-[(R)-cyclopentyl-(3-ethoxyphenyl)methyl]piperazine;dihydrochloride (PubChem CID 171290527) has the molecular formula C18H30Cl2N2O and a molecular weight of 361.36 g/mol. Its IUPAC name is 1-[(R)-cyclopentyl-(3-ethoxyphenyl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-cyclopentyl-(3-ethoxyphenyl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171290527 |
| Molecular Formula | C18H30Cl2N2O |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 1-[(R)-cyclopentyl-(3-ethoxyphenyl)methyl]piperazine;dihydrochloride |
| SMILES | CCOc1cccc([C@@H](C2CCCC2)N2CCNCC2)c1.Cl.Cl |
| InChI | InChI=1S/C18H28N2O.2ClH/c1-2-21-17-9-5-8-16(14-17)18(15-6-3-4-7-15)20-12-10-19-11-13-20;;/h5,8-9,14-15,18-19H,2-4,6-7,10-13H2,1H3;2*1H/t18-;;/m1../s1 |
| InChIKey | NWSHYXXSRHFVFP-JPKZNVRTSA-N |
| XLogP | 4.07 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |