C17H24F2N2O — CID 171165047
1-[(S)-cyclopentyl-[3-(difluoromethoxy)phenyl]methyl]piperazine (PubChem CID 171165047) has the molecular formula C17H24F2N2O and a molecular weight of 310.39 g/mol. Its IUPAC name is 1-[(S)-cyclopentyl-[3-(difluoromethoxy)phenyl]methyl]piperazine.
| Compound Name | 1-[(S)-cyclopentyl-[3-(difluoromethoxy)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171165047 |
| Molecular Formula | C17H24F2N2O |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 1-[(S)-cyclopentyl-[3-(difluoromethoxy)phenyl]methyl]piperazine |
| SMILES | FC(F)Oc1cccc([C@H](C2CCCC2)N2CCNCC2)c1 |
| InChI | InChI=1S/C17H24F2N2O/c18-17(19)22-15-7-3-6-14(12-15)16(13-4-1-2-5-13)21-10-8-20-9-11-21/h3,6-7,12-13,16-17,20H,1-2,4-5,8-11H2/t16-/m0/s1 |
| InChIKey | JYEQNJJXAKAOJG-INIZCTEOSA-N |
| XLogP | 3.42 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |