C17H25IN2 — CID 171293328
1-[(R)-cyclohexyl-(3-iodophenyl)methyl]piperazine (PubChem CID 171293328) has the molecular formula C17H25IN2 and a molecular weight of 384.31 g/mol. Its IUPAC name is 1-[(R)-cyclohexyl-(3-iodophenyl)methyl]piperazine.
| Compound Name | 1-[(R)-cyclohexyl-(3-iodophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 171293328 |
| Molecular Formula | C17H25IN2 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 1-[(R)-cyclohexyl-(3-iodophenyl)methyl]piperazine |
| SMILES | Ic1cccc([C@@H](C2CCCCC2)N2CCNCC2)c1 |
| InChI | InChI=1S/C17H25IN2/c18-16-8-4-7-15(13-16)17(14-5-2-1-3-6-14)20-11-9-19-10-12-20/h4,7-8,13-14,17,19H,1-3,5-6,9-12H2/t17-/m1/s1 |
| InChIKey | JHWKMBGLBIHMSP-QGZVFWFLSA-N |
| XLogP | 3.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|