C21H28N2 — CID 171287522
1-[(R)-cyclohexyl(naphthalen-2-yl)methyl]piperazine (PubChem CID 171287522) has the molecular formula C21H28N2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 1-[(R)-cyclohexyl(naphthalen-2-yl)methyl]piperazine.
| Compound Name | 1-[(R)-cyclohexyl(naphthalen-2-yl)methyl]piperazine |
|---|---|
| PubChem CID | 171287522 |
| Molecular Formula | C21H28N2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 1-[(R)-cyclohexyl(naphthalen-2-yl)methyl]piperazine |
| SMILES | c1ccc2cc([C@@H](C3CCCCC3)N3CCNCC3)ccc2c1 |
| InChI | InChI=1S/C21H28N2/c1-2-7-18(8-3-1)21(23-14-12-22-13-15-23)20-11-10-17-6-4-5-9-19(17)16-20/h4-6,9-11,16,18,21-22H,1-3,7-8,12-15H2/t21-/m1/s1 |
| InChIKey | BFMJSGJMNOJUFA-OAQYLSRUSA-N |
| XLogP | 4.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |