C19H27N3 — CID 171290490
6-[(R)-cyclohexyl(piperazin-1-yl)methyl]-1H-indole (PubChem CID 171290490) has the molecular formula C19H27N3 and a molecular weight of 297.45 g/mol. Its IUPAC name is 6-[(R)-cyclohexyl(piperazin-1-yl)methyl]-1H-indole.
| Compound Name | 6-[(R)-cyclohexyl(piperazin-1-yl)methyl]-1H-indole |
|---|---|
| PubChem CID | 171290490 |
| Molecular Formula | C19H27N3 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 6-[(R)-cyclohexyl(piperazin-1-yl)methyl]-1H-indole |
| SMILES | c1cc2ccc([C@@H](C3CCCCC3)N3CCNCC3)cc2[nH]1 |
| InChI | InChI=1S/C19H27N3/c1-2-4-16(5-3-1)19(22-12-10-20-11-13-22)17-7-6-15-8-9-21-18(15)14-17/h6-9,14,16,19-21H,1-5,10-13H2/t19-/m1/s1 |
| InChIKey | HRSRLEXEBOZAKN-LJQANCHMSA-N |
| XLogP | 3.69 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |