C24H25NO2 — CID 171217975
(S)-cyclopentyl-(3,4-diphenoxyphenyl)methanamine (PubChem CID 171217975) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is (S)-cyclopentyl-(3,4-diphenoxyphenyl)methanamine.
| Compound Name | (S)-cyclopentyl-(3,4-diphenoxyphenyl)methanamine |
|---|---|
| PubChem CID | 171217975 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | (S)-cyclopentyl-(3,4-diphenoxyphenyl)methanamine |
| SMILES | N[C@H](c1ccc(Oc2ccccc2)c(Oc2ccccc2)c1)C1CCCC1 |
| InChI | InChI=1S/C24H25NO2/c25-24(18-9-7-8-10-18)19-15-16-22(26-20-11-3-1-4-12-20)23(17-19)27-21-13-5-2-6-14-21/h1-6,11-18,24H,7-10,25H2/t24-/m0/s1 |
| InChIKey | DLOPNBQTAXYHGC-DEOSSOPVSA-N |
| XLogP | 6.46 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |