C20H18FNO2 — CID 171217937
(1R)-1-(3,4-diphenoxyphenyl)-2-fluoroethanamine (PubChem CID 171217937) has the molecular formula C20H18FNO2 and a molecular weight of 323.37 g/mol. Its IUPAC name is (1R)-1-(3,4-diphenoxyphenyl)-2-fluoroethanamine.
| Compound Name | (1R)-1-(3,4-diphenoxyphenyl)-2-fluoroethanamine |
|---|---|
| PubChem CID | 171217937 |
| Molecular Formula | C20H18FNO2 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (1R)-1-(3,4-diphenoxyphenyl)-2-fluoroethanamine |
| SMILES | N[C@@H](CF)c1ccc(Oc2ccccc2)c(Oc2ccccc2)c1 |
| InChI | InChI=1S/C20H18FNO2/c21-14-18(22)15-11-12-19(23-16-7-3-1-4-8-16)20(13-15)24-17-9-5-2-6-10-17/h1-13,18H,14,22H2/t18-/m0/s1 |
| InChIKey | HZIRCXNYEOALFD-SFHVURJKSA-N |
| XLogP | 5.24 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |