C23H26ClNO2 — CID 171217962
(1S)-1-(3,4-diphenoxyphenyl)-3-methylbutan-1-amine;hydrochloride (PubChem CID 171217962) has the molecular formula C23H26ClNO2 and a molecular weight of 383.92 g/mol. Its IUPAC name is (1S)-1-(3,4-diphenoxyphenyl)-3-methylbutan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(3,4-diphenoxyphenyl)-3-methylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171217962 |
| Molecular Formula | C23H26ClNO2 |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (1S)-1-(3,4-diphenoxyphenyl)-3-methylbutan-1-amine;hydrochloride |
| SMILES | CC(C)C[C@H](N)c1ccc(Oc2ccccc2)c(Oc2ccccc2)c1.Cl |
| InChI | InChI=1S/C23H25NO2.ClH/c1-17(2)15-21(24)18-13-14-22(25-19-9-5-3-6-10-19)23(16-18)26-20-11-7-4-8-12-20;/h3-14,16-17,21H,15,24H2,1-2H3;1H/t21-;/m0./s1 |
| InChIKey | UIQQVBHWRNKRTG-BOXHHOBZSA-N |
| XLogP | 6.74 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |