C22H21NO4 — CID 171238957
methyl (3S)-3-amino-3-(3,4-diphenoxyphenyl)propanoate (PubChem CID 171238957) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-(3,4-diphenoxyphenyl)propanoate.
| Compound Name | methyl (3S)-3-amino-3-(3,4-diphenoxyphenyl)propanoate |
|---|---|
| PubChem CID | 171238957 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | methyl (3S)-3-amino-3-(3,4-diphenoxyphenyl)propanoate |
| SMILES | COC(=O)C[C@H](N)c1ccc(Oc2ccccc2)c(Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H21NO4/c1-25-22(24)15-19(23)16-12-13-20(26-17-8-4-2-5-9-17)21(14-16)27-18-10-6-3-7-11-18/h2-14,19H,15,23H2,1H3/t19-/m0/s1 |
| InChIKey | QTOVCKGIXMMVCL-IBGZPJMESA-N |
| XLogP | 4.83 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |