C22H24ClNO3 — CID 171198482
(4R)-4-amino-4-(3,4-diphenoxyphenyl)butan-1-ol;hydrochloride (PubChem CID 171198482) has the molecular formula C22H24ClNO3 and a molecular weight of 385.89 g/mol. Its IUPAC name is (4R)-4-amino-4-(3,4-diphenoxyphenyl)butan-1-ol;hydrochloride.
| Compound Name | (4R)-4-amino-4-(3,4-diphenoxyphenyl)butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171198482 |
| Molecular Formula | C22H24ClNO3 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | (4R)-4-amino-4-(3,4-diphenoxyphenyl)butan-1-ol;hydrochloride |
| SMILES | Cl.N[C@H](CCCO)c1ccc(Oc2ccccc2)c(Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H23NO3.ClH/c23-20(12-7-15-24)17-13-14-21(25-18-8-3-1-4-9-18)22(16-17)26-19-10-5-2-6-11-19;/h1-6,8-11,13-14,16,20,24H,7,12,15,23H2;1H/t20-;/m1./s1 |
| InChIKey | KFGGEJMXKKAVMZ-VEIFNGETSA-N |
| XLogP | 5.47 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |