C21H20ClNO4 — CID 171217992
methyl (2R)-2-amino-2-(3,4-diphenoxyphenyl)acetate;hydrochloride (PubChem CID 171217992) has the molecular formula C21H20ClNO4 and a molecular weight of 385.85 g/mol. Its IUPAC name is methyl (2R)-2-amino-2-(3,4-diphenoxyphenyl)acetate;hydrochloride.
| Compound Name | methyl (2R)-2-amino-2-(3,4-diphenoxyphenyl)acetate;hydrochloride |
|---|---|
| PubChem CID | 171217992 |
| Molecular Formula | C21H20ClNO4 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | methyl (2R)-2-amino-2-(3,4-diphenoxyphenyl)acetate;hydrochloride |
| SMILES | COC(=O)[C@H](N)c1ccc(Oc2ccccc2)c(Oc2ccccc2)c1.Cl |
| InChI | InChI=1S/C21H19NO4.ClH/c1-24-21(23)20(22)15-12-13-18(25-16-8-4-2-5-9-16)19(14-15)26-17-10-6-3-7-11-17;/h2-14,20H,22H2,1H3;1H/t20-;/m1./s1 |
| InChIKey | HEHWDTIQTOQLOQ-VEIFNGETSA-N |
| XLogP | 4.87 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |