C19H26ClNO3 — CID 171230057
(4S)-4-amino-4-(3-ethoxy-4-phenylmethoxyphenyl)butan-1-ol;hydrochloride (PubChem CID 171230057) has the molecular formula C19H26ClNO3 and a molecular weight of 351.87 g/mol. Its IUPAC name is (4S)-4-amino-4-(3-ethoxy-4-phenylmethoxyphenyl)butan-1-ol;hydrochloride.
| Compound Name | (4S)-4-amino-4-(3-ethoxy-4-phenylmethoxyphenyl)butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171230057 |
| Molecular Formula | C19H26ClNO3 |
| Molecular Weight | 351.87 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (4S)-4-amino-4-(3-ethoxy-4-phenylmethoxyphenyl)butan-1-ol;hydrochloride |
| SMILES | CCOc1cc([C@@H](N)CCCO)ccc1OCc1ccccc1.Cl |
| InChI | InChI=1S/C19H25NO3.ClH/c1-2-22-19-13-16(17(20)9-6-12-21)10-11-18(19)23-14-15-7-4-3-5-8-15;/h3-5,7-8,10-11,13,17,21H,2,6,9,12,14,20H2,1H3;1H/t17-;/m0./s1 |
| InChIKey | MIQBGZSNZPPUSO-LMOVPXPDSA-N |
| XLogP | 3.86 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.87 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |