C19H26ClNO2 — CID 171212991
(1R)-1-(4-methoxy-3-phenylmethoxyphenyl)pentan-1-amine;hydrochloride (PubChem CID 171212991) has the molecular formula C19H26ClNO2 and a molecular weight of 335.88 g/mol. Its IUPAC name is (1R)-1-(4-methoxy-3-phenylmethoxyphenyl)pentan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(4-methoxy-3-phenylmethoxyphenyl)pentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171212991 |
| Molecular Formula | C19H26ClNO2 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (1R)-1-(4-methoxy-3-phenylmethoxyphenyl)pentan-1-amine;hydrochloride |
| SMILES | CCCC[C@@H](N)c1ccc(OC)c(OCc2ccccc2)c1.Cl |
| InChI | InChI=1S/C19H25NO2.ClH/c1-3-4-10-17(20)16-11-12-18(21-2)19(13-16)22-14-15-8-6-5-7-9-15;/h5-9,11-13,17H,3-4,10,14,20H2,1-2H3;1H/t17-;/m1./s1 |
| InChIKey | VSRYDQYKXJMPHZ-UNTBIKODSA-N |
| XLogP | 4.89 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |