C19H27ClN2O2 — CID 171212979
(1R)-1-(4-methoxy-3-phenylmethoxyphenyl)pentane-1,5-diamine;hydrochloride (PubChem CID 171212979) has the molecular formula C19H27ClN2O2 and a molecular weight of 350.89 g/mol. Its IUPAC name is (1R)-1-(4-methoxy-3-phenylmethoxyphenyl)pentane-1,5-diamine;hydrochloride.
| Compound Name | (1R)-1-(4-methoxy-3-phenylmethoxyphenyl)pentane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 171212979 |
| Molecular Formula | C19H27ClN2O2 |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | (1R)-1-(4-methoxy-3-phenylmethoxyphenyl)pentane-1,5-diamine;hydrochloride |
| SMILES | COc1ccc([C@H](N)CCCCN)cc1OCc1ccccc1.Cl |
| InChI | InChI=1S/C19H26N2O2.ClH/c1-22-18-11-10-16(17(21)9-5-6-12-20)13-19(18)23-14-15-7-3-2-4-8-15;/h2-4,7-8,10-11,13,17H,5-6,9,12,14,20-21H2,1H3;1H/t17-;/m1./s1 |
| InChIKey | PQDJMAJOBQLPKZ-UNTBIKODSA-N |
| XLogP | 3.82 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|